C20H23F3O4S2 — CID 126710675
1-methylsulfonyl-3-propan-2-yl-5-[2-[3-(trifluoromethylsulfonyl)phenyl]propyl]benzene (PubChem CID 126710675) has the molecular formula C20H23F3O4S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-methylsulfonyl-3-propan-2-yl-5-[2-[3-(trifluoromethylsulfonyl)phenyl]propyl]benzene.
| Compound Name | 1-methylsulfonyl-3-propan-2-yl-5-[2-[3-(trifluoromethylsulfonyl)phenyl]propyl]benzene |
|---|---|
| PubChem CID | 126710675 |
| Molecular Formula | C20H23F3O4S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 1-methylsulfonyl-3-propan-2-yl-5-[2-[3-(trifluoromethylsulfonyl)phenyl]propyl]benzene |
| SMILES | CC(C)c1cc(CC(C)c2cccc(S(=O)(=O)C(F)(F)F)c2)cc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H23F3O4S2/c1-13(2)17-9-15(10-19(12-17)28(4,24)25)8-14(3)16-6-5-7-18(11-16)29(26,27)20(21,22)23/h5-7,9-14H,8H2,1-4H3 |
| InChIKey | AEGNGYKNVRYHOJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |