C12H9F3O7S — CID 170261722
2-oxo-3-[3-(trifluoromethylsulfonyl)phenyl]pentanedioic acid (PubChem CID 170261722) has the molecular formula C12H9F3O7S and a molecular weight of 354.26 g/mol. Its IUPAC name is 2-oxo-3-[3-(trifluoromethylsulfonyl)phenyl]pentanedioic acid.
| Compound Name | 2-oxo-3-[3-(trifluoromethylsulfonyl)phenyl]pentanedioic acid |
|---|---|
| PubChem CID | 170261722 |
| Molecular Formula | C12H9F3O7S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 2-oxo-3-[3-(trifluoromethylsulfonyl)phenyl]pentanedioic acid |
| SMILES | O=C(O)CC(C(=O)C(=O)O)c1cccc(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F3O7S/c13-12(14,15)23(21,22)7-3-1-2-6(4-7)8(5-9(16)17)10(18)11(19)20/h1-4,8H,5H2,(H,16,17)(H,19,20) |
| InChIKey | GQDKHBYSDZBYNP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|