C21H26N2O2S — CID 134370030
N-[[3-[1-(3-cyano-5-propan-2-ylphenyl)propan-2-yl]phenyl]methyl]methanesulfonamide (PubChem CID 134370030) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is N-[[3-[1-(3-cyano-5-propan-2-ylphenyl)propan-2-yl]phenyl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[1-(3-cyano-5-propan-2-ylphenyl)propan-2-yl]phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 134370030 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[[3-[1-(3-cyano-5-propan-2-ylphenyl)propan-2-yl]phenyl]methyl]methanesulfonamide |
| SMILES | CC(C)c1cc(C#N)cc(CC(C)c2cccc(CNS(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C21H26N2O2S/c1-15(2)21-11-18(9-19(12-21)13-22)8-16(3)20-7-5-6-17(10-20)14-23-26(4,24)25/h5-7,9-12,15-16,23H,8,14H2,1-4H3 |
| InChIKey | DGFFYFYJYAXDLK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |