C21H19F5N2O3 — CID 126710768
N-[2-(3,4-difluorophenyl)ethyl]-N'-[2-(3,4-difluorophenyl)-2-fluoroethyl]-N'-formyl-N-methylpropanediamide (PubChem CID 126710768) has the molecular formula C21H19F5N2O3 and a molecular weight of 442.38 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)ethyl]-N'-[2-(3,4-difluorophenyl)-2-fluoroethyl]-N'-formyl-N-methylpropanediamide.
| Compound Name | N-[2-(3,4-difluorophenyl)ethyl]-N'-[2-(3,4-difluorophenyl)-2-fluoroethyl]-N'-formyl-N-methylpropanediamide |
|---|---|
| PubChem CID | 126710768 |
| Molecular Formula | C21H19F5N2O3 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)ethyl]-N'-[2-(3,4-difluorophenyl)-2-fluoroethyl]-N'-formyl-N-methylpropanediamide |
| SMILES | CN(CCc1ccc(F)c(F)c1)C(=O)CC(=O)N(C=O)CC(F)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H19F5N2O3/c1-27(7-6-13-2-4-15(22)17(24)8-13)20(30)10-21(31)28(12-29)11-19(26)14-3-5-16(23)18(25)9-14/h2-5,8-9,12,19H,6-7,10-11H2,1H3 |
| InChIKey | GDUXYBLLOVAVSR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|