C12H16F2N2O2 — CID 126711019
1-[4-(2,2-difluorobutoxy)-6-ethylpyrimidin-5-yl]ethanone (PubChem CID 126711019) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-[4-(2,2-difluorobutoxy)-6-ethylpyrimidin-5-yl]ethanone.
| Compound Name | 1-[4-(2,2-difluorobutoxy)-6-ethylpyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 126711019 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[4-(2,2-difluorobutoxy)-6-ethylpyrimidin-5-yl]ethanone |
| SMILES | CCc1ncnc(OCC(F)(F)CC)c1C(C)=O |
| InChI | InChI=1S/C12H16F2N2O2/c1-4-9-10(8(3)17)11(16-7-15-9)18-6-12(13,14)5-2/h7H,4-6H2,1-3H3 |
| InChIKey | XGCLHKOXLFAJPP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |