C11H14F2N2O2 — CID 154949232
1-[4-(2,2-difluoropropoxy)-6-ethylpyrimidin-5-yl]ethanone (PubChem CID 154949232) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 1-[4-(2,2-difluoropropoxy)-6-ethylpyrimidin-5-yl]ethanone.
| Compound Name | 1-[4-(2,2-difluoropropoxy)-6-ethylpyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 154949232 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-[4-(2,2-difluoropropoxy)-6-ethylpyrimidin-5-yl]ethanone |
| SMILES | CCc1ncnc(OCC(C)(F)F)c1C(C)=O |
| InChI | InChI=1S/C11H14F2N2O2/c1-4-8-9(7(2)16)10(15-6-14-8)17-5-11(3,12)13/h6H,4-5H2,1-3H3 |
| InChIKey | BRLGWVMGNQRUOX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |