C24H31F2N3O — CID 126711224
1-Benzyl-3-(3,4-difluorophenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea (PubChem CID 126711224) has the molecular formula C24H31F2N3O and a molecular weight of 415.50 g/mol. Its IUPAC name is 1-benzyl-3-(3,4-difluorophenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-Benzyl-3-(3,4-difluorophenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 126711224 |
| Molecular Formula | C24H31F2N3O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-benzyl-3-(3,4-difluorophenyl)-1-(1-pentan-2-ylpiperidin-4-yl)urea |
| SMILES | CCCC(C)N1CCC(CC1)N(CC2=CC=CC=C2)C(=O)NC3=CC(=C(C=C3)F)F |
| InChI | InChI=1S/C24H31F2N3O/c1-3-7-18(2)28-14-12-21(13-15-28)29(17-19-8-5-4-6-9-19)24(30)27-20-10-11-22(25)23(26)16-20/h4-6,8-11,16,18,21H,3,7,12-15,17H2,1-2H3,(H,27,30) |
| InChIKey | KFGVTSJDQVXIPB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 35.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | 521 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |