C25H31ClF3N3O — CID 126711696
1-benzyl-3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(1-pentan-2-ylpiperidin-4-yl)urea (PubChem CID 126711696) has the molecular formula C25H31ClF3N3O and a molecular weight of 481.99 g/mol. Its IUPAC name is 1-benzyl-3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(1-pentan-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-benzyl-3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(1-pentan-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 126711696 |
| Molecular Formula | C25H31ClF3N3O |
| Molecular Weight | 481.99 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 1-benzyl-3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(1-pentan-2-ylpiperidin-4-yl)urea |
| SMILES | CCCC(C)N1CCC(N(Cc2ccccc2)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C25H31ClF3N3O/c1-3-7-18(2)31-14-12-21(13-15-31)32(17-19-8-5-4-6-9-19)24(33)30-23-16-20(25(27,28)29)10-11-22(23)26/h4-6,8-11,16,18,21H,3,7,12-15,17H2,1-2H3,(H,30,33) |
| InChIKey | PJWAIFCUFVNLHJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.99 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |