C25H32F3N3O2 — CID 126711752
1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 126711752) has the molecular formula C25H32F3N3O2 and a molecular weight of 463.54 g/mol. Its IUPAC name is 1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 126711752 |
| Molecular Formula | C25H32F3N3O2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CCCC(C)N1CCC(N(Cc2ccccc2)C(=O)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C25H32F3N3O2/c1-3-7-19(2)30-16-14-22(15-17-30)31(18-20-8-5-4-6-9-20)24(32)29-21-10-12-23(13-11-21)33-25(26,27)28/h4-6,8-13,19,22H,3,7,14-18H2,1-2H3,(H,29,32) |
| InChIKey | WNGADQKPSOCGNJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |