C19H26N4O4 — CID 126712402
(8aS)-N-benzyl-3-[[(2S)-2-(methylamino)propanoyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide (PubChem CID 126712402) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is (8aS)-N-benzyl-3-[[(2S)-2-(methylamino)propanoyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide.
| Compound Name | (8aS)-N-benzyl-3-[[(2S)-2-(methylamino)propanoyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 126712402 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (8aS)-N-benzyl-3-[[(2S)-2-(methylamino)propanoyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide |
| SMILES | CN[C@@H](C)C(=O)NC1CO[C@H]2CCC(C(=O)NCc3ccccc3)N2C1=O |
| InChI | InChI=1S/C19H26N4O4/c1-12(20-2)17(24)22-14-11-27-16-9-8-15(23(16)19(14)26)18(25)21-10-13-6-4-3-5-7-13/h3-7,12,14-16,20H,8-11H2,1-2H3,(H,21,25)(H,22,24)/t12-,14?,15?,16-/m0/s1 |
| InChIKey | JVKFFBGNOJIZCH-MFNGEMCRSA-N |
| XLogP | -0.26 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |