C22H32N4O4 — CID 70900699
(3S,6S,9aS)-N-benzyl-6-[[(2S)-2-(2-hydroxyethylamino)propanoyl]amino]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide (PubChem CID 70900699) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (3S,6S,9aS)-N-benzyl-6-[[(2S)-2-(2-hydroxyethylamino)propanoyl]amino]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide.
| Compound Name | (3S,6S,9aS)-N-benzyl-6-[[(2S)-2-(2-hydroxyethylamino)propanoyl]amino]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide |
|---|---|
| PubChem CID | 70900699 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (3S,6S,9aS)-N-benzyl-6-[[(2S)-2-(2-hydroxyethylamino)propanoyl]amino]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide |
| SMILES | C[C@H](NCCO)C(=O)N[C@H]1CCC[C@H]2CC[C@@H](C(=O)NCc3ccccc3)N2C1=O |
| InChI | InChI=1S/C22H32N4O4/c1-15(23-12-13-27)20(28)25-18-9-5-8-17-10-11-19(26(17)22(18)30)21(29)24-14-16-6-3-2-4-7-16/h2-4,6-7,15,17-19,23,27H,5,8-14H2,1H3,(H,24,29)(H,25,28)/t15-,17-,18-,19-/m0/s1 |
| InChIKey | OSIZWROAAZAHID-WNHJNPCNSA-N |
| XLogP | 0.30 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |