C15H24S — CID 126713363
1-(2-methylpropyl)-3-(2-methylpropylsulfanylmethyl)benzene (PubChem CID 126713363) has the molecular formula C15H24S and a molecular weight of 236.42 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-(2-methylpropylsulfanylmethyl)benzene.
| Compound Name | 1-(2-methylpropyl)-3-(2-methylpropylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 126713363 |
| Molecular Formula | C15H24S |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-(2-methylpropyl)-3-(2-methylpropylsulfanylmethyl)benzene |
| SMILES | CC(C)CSCc1cccc(CC(C)C)c1 |
| InChI | InChI=1S/C15H24S/c1-12(2)8-14-6-5-7-15(9-14)11-16-10-13(3)4/h5-7,9,12-13H,8,10-11H2,1-4H3 |
| InChIKey | IKAZVEWOHVUSAE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |