C30H48 — CID 158814859
1-(3-methylbutyl)-3-(2-methylpropyl)benzene;1-(3-methylbutyl)-4-(2-methylpropyl)benzene (PubChem CID 158814859) has the molecular formula C30H48 and a molecular weight of 408.71 g/mol. Its IUPAC name is 1-(3-methylbutyl)-3-(2-methylpropyl)benzene;1-(3-methylbutyl)-4-(2-methylpropyl)benzene.
| Compound Name | 1-(3-methylbutyl)-3-(2-methylpropyl)benzene;1-(3-methylbutyl)-4-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 158814859 |
| Molecular Formula | C30H48 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | 1-(3-methylbutyl)-3-(2-methylpropyl)benzene;1-(3-methylbutyl)-4-(2-methylpropyl)benzene |
| SMILES | CC(C)CCc1ccc(CC(C)C)cc1.CC(C)CCc1cccc(CC(C)C)c1 |
| InChI | InChI=1S/2C15H24/c1-12(2)5-6-14-7-9-15(10-8-14)11-13(3)4;1-12(2)8-9-14-6-5-7-15(11-14)10-13(3)4/h7-10,12-13H,5-6,11H2,1-4H3;5-7,11-13H,8-10H2,1-4H3 |
| InChIKey | IVDFZAKEJRALQW-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |