C24H38N4 — CID 126713399
4-N-pentan-3-yl-1-N-[2-[4-(pentan-3-ylamino)anilino]ethyl]benzene-1,4-diamine (PubChem CID 126713399) has the molecular formula C24H38N4 and a molecular weight of 382.60 g/mol. Its IUPAC name is 4-N-pentan-3-yl-1-N-[2-[4-(pentan-3-ylamino)anilino]ethyl]benzene-1,4-diamine.
| Compound Name | 4-N-pentan-3-yl-1-N-[2-[4-(pentan-3-ylamino)anilino]ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 126713399 |
| Molecular Formula | C24H38N4 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | 4-N-pentan-3-yl-1-N-[2-[4-(pentan-3-ylamino)anilino]ethyl]benzene-1,4-diamine |
| SMILES | CCC(CC)Nc1ccc(NCCNc2ccc(NC(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C24H38N4/c1-5-19(6-2)27-23-13-9-21(10-14-23)25-17-18-26-22-11-15-24(16-12-22)28-20(7-3)8-4/h9-16,19-20,25-28H,5-8,17-18H2,1-4H3 |
| InChIKey | QRAXDXMBWPXABX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|