C16H20F2N6O4S2 — CID 126714996
N-[2-[(5S,6S)-3-amino-1,1-dihydroxy-2,5,6-trimethyl-6H-1,2,4-thiadiazin-5-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide (PubChem CID 126714996) has the molecular formula C16H20F2N6O4S2 and a molecular weight of 462.50 g/mol. Its IUPAC name is N-[2-[(5S,6S)-3-amino-1,1-dihydroxy-2,5,6-trimethyl-6H-1,2,4-thiadiazin-5-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide.
| Compound Name | N-[2-[(5S,6S)-3-amino-1,1-dihydroxy-2,5,6-trimethyl-6H-1,2,4-thiadiazin-5-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 126714996 |
| Molecular Formula | C16H20F2N6O4S2 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | N-[2-[(5S,6S)-3-amino-1,1-dihydroxy-2,5,6-trimethyl-6H-1,2,4-thiadiazin-5-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide |
| SMILES | C[C@H]1[C@@](C)(c2nc(NC(=O)c3ccc(OC(F)F)cn3)cs2)N=C(N)N(C)S1(O)O |
| InChI | InChI=1S/C16H20F2N6O4S2/c1-8-16(2,23-15(19)24(3)30(8,26)27)13-22-11(7-29-13)21-12(25)10-5-4-9(6-20-10)28-14(17)18/h4-8,14,26-27H,1-3H3,(H2,19,23)(H,21,25)/t8-,16-/m0/s1 |
| InChIKey | FKVUZHXNPHDTBQ-PWJLMRLQSA-N |
| XLogP | 2.92 |
| TPSA | 146.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |