C11H20F2N2O2 — CID 126716147
(5S)-N-butyl-3-(difluoromethyl)-5-hydroxypiperidine-1-carboxamide (PubChem CID 126716147) has the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. Its IUPAC name is (5S)-N-butyl-3-(difluoromethyl)-5-hydroxypiperidine-1-carboxamide.
| Compound Name | (5S)-N-butyl-3-(difluoromethyl)-5-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 126716147 |
| Molecular Formula | C11H20F2N2O2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (5S)-N-butyl-3-(difluoromethyl)-5-hydroxypiperidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CC(C(F)F)C[C@H](O)C1 |
| InChI | InChI=1S/C11H20F2N2O2/c1-2-3-4-14-11(17)15-6-8(10(12)13)5-9(16)7-15/h8-10,16H,2-7H2,1H3,(H,14,17)/t8?,9-/m0/s1 |
| InChIKey | IUHJFGFNVFDURI-GKAPJAKFSA-N |
| XLogP | 1.44 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|