C9H17F2N — CID 126716416
1-(1,1-difluoropropan-2-yl)-4-methylpiperidine (PubChem CID 126716416) has the molecular formula C9H17F2N and a molecular weight of 177.24 g/mol. Its IUPAC name is 1-(1,1-difluoropropan-2-yl)-4-methylpiperidine.
| Compound Name | 1-(1,1-difluoropropan-2-yl)-4-methylpiperidine |
|---|---|
| PubChem CID | 126716416 |
| Molecular Formula | C9H17F2N |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-(1,1-difluoropropan-2-yl)-4-methylpiperidine |
| SMILES | CC1CCN(C(C)C(F)F)CC1 |
| InChI | InChI=1S/C9H17F2N/c1-7-3-5-12(6-4-7)8(2)9(10)11/h7-9H,3-6H2,1-2H3 |
| InChIKey | NDOMAZXSMPKQGI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |