About 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide
4-methyl-1-propan-2-ylpiperidine;sulfur dioxide (PubChem CID 161459747) has the molecular formula C9H19NO2S
and a molecular weight of 205.32 g/mol. Its IUPAC name is 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide.
Molecular Properties
| Compound Name | 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide |
| PubChem CID | 161459747 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide |
| SMILES | CC1CCN(C(C)C)CC1.O=S=O |
| InChI | InChI=1S/C9H19N.O2S/c1-8(2)10-6-4-9(3)5-7-10;1-3-2/h8-9H,4-7H2,1-3H3; |
| InChIKey | WBQGJEMXGGKLCX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide?
The IUPAC name of 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide (CID 161459747) is 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide.
What is the SMILES notation for 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide?
The canonical SMILES for 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide is CC1CCN(C(C)C)CC1.O=S=O.
What is the InChIKey of 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide?
The InChIKey is WBQGJEMXGGKLCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.O2S/c1-8(2)10-6-4-9(3)5-7-10;1-3-2/h8-9H,4-7H2,1-3H3;.
What are the key properties of 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide?
4-methyl-1-propan-2-ylpiperidine;sulfur dioxide has a molecular weight of 205.32 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-propan-2-ylpiperidine;sulfur dioxide is sourced from PubChem (CID 161459747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).