C24H16N4O4S2 — CID 126719294
N-[[2-(4-nitrophenyl)-1,3-thiazol-5-yl]methyl]-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 126719294) has the molecular formula C24H16N4O4S2 and a molecular weight of 488.55 g/mol. Its IUPAC name is N-[[2-(4-nitrophenyl)-1,3-thiazol-5-yl]methyl]-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[[2-(4-nitrophenyl)-1,3-thiazol-5-yl]methyl]-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 126719294 |
| Molecular Formula | C24H16N4O4S2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | N-[[2-(4-nitrophenyl)-1,3-thiazol-5-yl]methyl]-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(NCc1cnc(-c2ccc([N+](=O)[O-])cc2)s1)c1ccc2c(c1)NC(=O)c1ccccc1S2 |
| InChI | InChI=1S/C24H16N4O4S2/c29-22(25-12-17-13-26-24(33-17)14-5-8-16(9-6-14)28(31)32)15-7-10-21-19(11-15)27-23(30)18-3-1-2-4-20(18)34-21/h1-11,13H,12H2,(H,25,29)(H,27,30) |
| InChIKey | AWESQDXHIQSYHW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|