C24H18N4O4S2 — CID 126719448
N-[[2-(4-aminophenyl)-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 126719448) has the molecular formula C24H18N4O4S2 and a molecular weight of 490.57 g/mol. Its IUPAC name is N-[[2-(4-aminophenyl)-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[[2-(4-aminophenyl)-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 126719448 |
| Molecular Formula | C24H18N4O4S2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | N-[[2-(4-aminophenyl)-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | Nc1ccc(-c2ncc(CNC(=O)c3ccc4c(c3)NC(=O)c3ccccc3S4(=O)=O)s2)cc1 |
| InChI | InChI=1S/C24H18N4O4S2/c25-16-8-5-14(6-9-16)24-27-13-17(33-24)12-26-22(29)15-7-10-21-19(11-15)28-23(30)18-3-1-2-4-20(18)34(21,31)32/h1-11,13H,12,25H2,(H,26,29)(H,28,30) |
| InChIKey | DMBKANLCCNGXIG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|