C33H33N5O7S2 — CID 139394236
tert-butyl N-methyl-N-[2-[[4-[5-[[(6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carbonyl)amino]methyl]-1,3-thiazol-2-yl]benzoyl]amino]ethyl]carbamate (PubChem CID 139394236) has the molecular formula C33H33N5O7S2 and a molecular weight of 675.79 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[[4-[5-[[(6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carbonyl)amino]methyl]-1,3-thiazol-2-yl]benzoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[[4-[5-[[(6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carbonyl)amino]methyl]-1,3-thiazol-2-yl]benzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 139394236 |
| Molecular Formula | C33H33N5O7S2 |
| Molecular Weight | 675.79 g/mol |
| Exact Mass | 675.18 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[[4-[5-[[(6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carbonyl)amino]methyl]-1,3-thiazol-2-yl]benzoyl]amino]ethyl]carbamate |
| SMILES | CN(CCNC(=O)c1ccc(-c2ncc(CNC(=O)c3ccc4c(c3)NC(=O)c3ccccc3S4(=O)=O)s2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H33N5O7S2/c1-33(2,3)45-32(42)38(4)16-15-34-28(39)20-9-11-21(12-10-20)31-36-19-23(46-31)18-35-29(40)22-13-14-27-25(17-22)37-30(41)24-7-5-6-8-26(24)47(27,43)44/h5-14,17,19H,15-16,18H2,1-4H3,(H,34,39)(H,35,40)(H,37,41) |
| InChIKey | AUNJORSLLNTTSV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 163.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.79 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |