C32H32N4O5S2 — CID 139394209
N-[[2-[4-[[1-[(dimethylamino)methyl]cyclobutyl]methoxy]phenyl]-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 139394209) has the molecular formula C32H32N4O5S2 and a molecular weight of 616.77 g/mol. Its IUPAC name is N-[[2-[4-[[1-[(dimethylamino)methyl]cyclobutyl]methoxy]phenyl]-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[[2-[4-[[1-[(dimethylamino)methyl]cyclobutyl]methoxy]phenyl]-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 139394209 |
| Molecular Formula | C32H32N4O5S2 |
| Molecular Weight | 616.77 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | N-[[2-[4-[[1-[(dimethylamino)methyl]cyclobutyl]methoxy]phenyl]-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CN(C)CC1(COc2ccc(-c3ncc(CNC(=O)c4ccc5c(c4)NC(=O)c4ccccc4S5(=O)=O)s3)cc2)CCC1 |
| InChI | InChI=1S/C32H32N4O5S2/c1-36(2)19-32(14-5-15-32)20-41-23-11-8-21(9-12-23)31-34-18-24(42-31)17-33-29(37)22-10-13-28-26(16-22)35-30(38)25-6-3-4-7-27(25)43(28,39)40/h3-4,6-13,16,18H,5,14-15,17,19-20H2,1-2H3,(H,33,37)(H,35,38) |
| InChIKey | BXMSJFUHIPOJEL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.77 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |