C32H32N4O4S2 — CID 140907484
N-[[2-[4-[4-[cyclopropyl(methyl)amino]butyl]phenyl]-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 140907484) has the molecular formula C32H32N4O4S2 and a molecular weight of 600.77 g/mol. Its IUPAC name is N-[[2-[4-[4-[cyclopropyl(methyl)amino]butyl]phenyl]-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[[2-[4-[4-[cyclopropyl(methyl)amino]butyl]phenyl]-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 140907484 |
| Molecular Formula | C32H32N4O4S2 |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | N-[[2-[4-[4-[cyclopropyl(methyl)amino]butyl]phenyl]-1,3-thiazol-5-yl]methyl]-6,11,11-trioxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CN(CCCCc1ccc(-c2ncc(CNC(=O)c3ccc4c(c3)NC(=O)c3ccccc3S4(=O)=O)s2)cc1)C1CC1 |
| InChI | InChI=1S/C32H32N4O4S2/c1-36(24-14-15-24)17-5-4-6-21-9-11-22(12-10-21)32-34-20-25(41-32)19-33-30(37)23-13-16-29-27(18-23)35-31(38)26-7-2-3-8-28(26)42(29,39)40/h2-3,7-13,16,18,20,24H,4-6,14-15,17,19H2,1H3,(H,33,37)(H,35,38) |
| InChIKey | AFGZGBOEHXLFLD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|