C24H22N4O2S — CID 126720435
3-(4-piperidin-4-ylphenyl)-5-(4-thiophen-2-yltriazol-1-yl)benzoic acid (PubChem CID 126720435) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-(4-piperidin-4-ylphenyl)-5-(4-thiophen-2-yltriazol-1-yl)benzoic acid.
| Compound Name | 3-(4-piperidin-4-ylphenyl)-5-(4-thiophen-2-yltriazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 126720435 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 3-(4-piperidin-4-ylphenyl)-5-(4-thiophen-2-yltriazol-1-yl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C3CCNCC3)cc2)cc(-n2cc(-c3cccs3)nn2)c1 |
| InChI | InChI=1S/C24H22N4O2S/c29-24(30)20-12-19(17-5-3-16(4-6-17)18-7-9-25-10-8-18)13-21(14-20)28-15-22(26-27-28)23-2-1-11-31-23/h1-6,11-15,18,25H,7-10H2,(H,29,30) |
| InChIKey | MRNNJVZWMRTENT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |