C26H22F2N4O2 — CID 135356790
3-[4-(3,4-difluorophenyl)triazol-1-yl]-5-(4-piperidin-4-ylphenyl)benzoic acid (PubChem CID 135356790) has the molecular formula C26H22F2N4O2 and a molecular weight of 460.48 g/mol. Its IUPAC name is 3-[4-(3,4-difluorophenyl)triazol-1-yl]-5-(4-piperidin-4-ylphenyl)benzoic acid.
| Compound Name | 3-[4-(3,4-difluorophenyl)triazol-1-yl]-5-(4-piperidin-4-ylphenyl)benzoic acid |
|---|---|
| PubChem CID | 135356790 |
| Molecular Formula | C26H22F2N4O2 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 3-[4-(3,4-difluorophenyl)triazol-1-yl]-5-(4-piperidin-4-ylphenyl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C3CCNCC3)cc2)cc(-n2cc(-c3ccc(F)c(F)c3)nn2)c1 |
| InChI | InChI=1S/C26H22F2N4O2/c27-23-6-5-19(14-24(23)28)25-15-32(31-30-25)22-12-20(11-21(13-22)26(33)34)17-3-1-16(2-4-17)18-7-9-29-10-8-18/h1-6,11-15,18,29H,7-10H2,(H,33,34) |
| InChIKey | GGEWYSIJGICGIF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |