C17H19F7N4O2 — CID 126721471
N-[[5-fluoro-6-(3,3,4,4,5,5-hexafluoropiperidin-1-yl)-2-methoxy-3-pyridinyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 126721471) has the molecular formula C17H19F7N4O2 and a molecular weight of 444.35 g/mol. Its IUPAC name is N-[[5-fluoro-6-(3,3,4,4,5,5-hexafluoropiperidin-1-yl)-2-methoxy-3-pyridinyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[[5-fluoro-6-(3,3,4,4,5,5-hexafluoropiperidin-1-yl)-2-methoxy-3-pyridinyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126721471 |
| Molecular Formula | C17H19F7N4O2 |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[[5-fluoro-6-(3,3,4,4,5,5-hexafluoropiperidin-1-yl)-2-methoxy-3-pyridinyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | COc1nc(N2CC(F)(F)C(F)(F)C(F)(F)C2)c(F)cc1CNC(=O)C1CCCN1 |
| InChI | InChI=1S/C17H19F7N4O2/c1-30-14-9(6-26-13(29)11-3-2-4-25-11)5-10(18)12(27-14)28-7-15(19,20)17(23,24)16(21,22)8-28/h5,11,25H,2-4,6-8H2,1H3,(H,26,29) |
| InChIKey | RCGSWRVYBSDANM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|