C16H20F5N3O3 — CID 126721972
(2S)-N-[[5-fluoro-2-methoxy-6-(3,3,4,4-tetrafluorobutan-2-yloxy)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 126721972) has the molecular formula C16H20F5N3O3 and a molecular weight of 397.34 g/mol. Its IUPAC name is (2S)-N-[[5-fluoro-2-methoxy-6-(3,3,4,4-tetrafluorobutan-2-yloxy)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[5-fluoro-2-methoxy-6-(3,3,4,4-tetrafluorobutan-2-yloxy)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126721972 |
| Molecular Formula | C16H20F5N3O3 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (2S)-N-[[5-fluoro-2-methoxy-6-(3,3,4,4-tetrafluorobutan-2-yloxy)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | COc1nc(OC(C)C(F)(F)C(F)F)c(F)cc1CNC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C16H20F5N3O3/c1-8(16(20,21)15(18)19)27-14-10(17)6-9(13(24-14)26-2)7-23-12(25)11-4-3-5-22-11/h6,8,11,15,22H,3-5,7H2,1-2H3,(H,23,25)/t8?,11-/m0/s1 |
| InChIKey | UGMJMLSYOLGZHC-LYNSQETBSA-N |
| XLogP | 2.27 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|