C16H19F5N2O3 — CID 135337681
(2S)-N-[[5-fluoro-2-methoxy-4-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 135337681) has the molecular formula C16H19F5N2O3 and a molecular weight of 382.33 g/mol. Its IUPAC name is (2S)-N-[[5-fluoro-2-methoxy-4-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[5-fluoro-2-methoxy-4-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135337681 |
| Molecular Formula | C16H19F5N2O3 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (2S)-N-[[5-fluoro-2-methoxy-4-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | COc1cc(OCC(F)(F)C(F)F)c(F)cc1CNC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C16H19F5N2O3/c1-25-12-6-13(26-8-16(20,21)15(18)19)10(17)5-9(12)7-23-14(24)11-3-2-4-22-11/h5-6,11,15,22H,2-4,7-8H2,1H3,(H,23,24)/t11-/m0/s1 |
| InChIKey | ZRKFTNGWSRGRET-NSHDSACASA-N |
| XLogP | 2.48 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|