C17H22F4N2O3 — CID 153319822
N-[[5-fluoro-2-methoxy-4-(4,4,4-trifluorobutoxy)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 153319822) has the molecular formula C17H22F4N2O3 and a molecular weight of 378.37 g/mol. Its IUPAC name is N-[[5-fluoro-2-methoxy-4-(4,4,4-trifluorobutoxy)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[[5-fluoro-2-methoxy-4-(4,4,4-trifluorobutoxy)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 153319822 |
| Molecular Formula | C17H22F4N2O3 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[[5-fluoro-2-methoxy-4-(4,4,4-trifluorobutoxy)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | COc1cc(OCCCC(F)(F)F)c(F)cc1CNC(=O)C1CCCN1 |
| InChI | InChI=1S/C17H22F4N2O3/c1-25-14-9-15(26-7-3-5-17(19,20)21)12(18)8-11(14)10-23-16(24)13-4-2-6-22-13/h8-9,13,22H,2-7,10H2,1H3,(H,23,24) |
| InChIKey | HLQKUSOXLMIWLE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|