C19H21F2N3O3 — CID 135337877
(2S)-N-[[5-fluoro-4-[(2-fluoro-4-pyridinyl)methoxy]-2-methoxyphenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 135337877) has the molecular formula C19H21F2N3O3 and a molecular weight of 377.39 g/mol. Its IUPAC name is (2S)-N-[[5-fluoro-4-[(2-fluoro-4-pyridinyl)methoxy]-2-methoxyphenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[5-fluoro-4-[(2-fluoro-4-pyridinyl)methoxy]-2-methoxyphenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135337877 |
| Molecular Formula | C19H21F2N3O3 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2S)-N-[[5-fluoro-4-[(2-fluoro-4-pyridinyl)methoxy]-2-methoxyphenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | COc1cc(OCc2ccnc(F)c2)c(F)cc1CNC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C19H21F2N3O3/c1-26-16-9-17(27-11-12-4-6-23-18(21)7-12)14(20)8-13(16)10-24-19(25)15-3-2-5-22-15/h4,6-9,15,22H,2-3,5,10-11H2,1H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | FWRMJXNKZKFBQC-HNNXBMFYSA-N |
| XLogP | 2.32 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|