C25H24N2O3 — CID 1267242
N-(2-cyano-4,5-diethoxyphenyl)-2,2-diphenylacetamide (PubChem CID 1267242) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(2-cyano-4,5-diethoxyphenyl)-2,2-diphenylacetamide.
| Compound Name | N-(2-cyano-4,5-diethoxyphenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 1267242 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(2-cyano-4,5-diethoxyphenyl)-2,2-diphenylacetamide |
| SMILES | CCOc1cc(C#N)c(NC(=O)C(c2ccccc2)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C25H24N2O3/c1-3-29-22-15-20(17-26)21(16-23(22)30-4-2)27-25(28)24(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-16,24H,3-4H2,1-2H3,(H,27,28) |
| InChIKey | TVPKMOPFNKYSTE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |