C15H32NO2P — CID 126724265
phosphanyl 2,2-dimethyl-8-(pentylamino)octanoate (PubChem CID 126724265) has the molecular formula C15H32NO2P and a molecular weight of 289.40 g/mol. Its IUPAC name is phosphanyl 2,2-dimethyl-8-(pentylamino)octanoate.
| Compound Name | phosphanyl 2,2-dimethyl-8-(pentylamino)octanoate |
|---|---|
| PubChem CID | 126724265 |
| Molecular Formula | C15H32NO2P |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | phosphanyl 2,2-dimethyl-8-(pentylamino)octanoate |
| SMILES | CCCCCNCCCCCCC(C)(C)C(=O)OP |
| InChI | InChI=1S/C15H32NO2P/c1-4-5-9-12-16-13-10-7-6-8-11-15(2,3)14(17)18-19/h16H,4-13,19H2,1-3H3 |
| InChIKey | NPWHUYKTDKIKGV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|