C23H23N3O3 — CID 126724309
(2R)-2-methyl-5-(4-phenylphenyl)-4-(pyrimidine-5-carbonylamino)pentanoic acid (PubChem CID 126724309) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is (2R)-2-methyl-5-(4-phenylphenyl)-4-(pyrimidine-5-carbonylamino)pentanoic acid.
| Compound Name | (2R)-2-methyl-5-(4-phenylphenyl)-4-(pyrimidine-5-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 126724309 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (2R)-2-methyl-5-(4-phenylphenyl)-4-(pyrimidine-5-carbonylamino)pentanoic acid |
| SMILES | C[C@H](CC(Cc1ccc(-c2ccccc2)cc1)NC(=O)c1cncnc1)C(=O)O |
| InChI | InChI=1S/C23H23N3O3/c1-16(23(28)29)11-21(26-22(27)20-13-24-15-25-14-20)12-17-7-9-19(10-8-17)18-5-3-2-4-6-18/h2-10,13-16,21H,11-12H2,1H3,(H,26,27)(H,28,29)/t16-,21?/m1/s1 |
| InChIKey | OMCRCFBAYVHZKU-UJONTBEJSA-N |
| XLogP | 3.60 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |