C27H23N5O4S — CID 126726158
[2-[4-formyloxy-6-[4-[2-(3-hexylthiophen-2-yl)ethynyl]-1,3,5-triazin-2-yl]-2-pyridinyl]-4-pyridinyl] formate (PubChem CID 126726158) has the molecular formula C27H23N5O4S and a molecular weight of 513.58 g/mol. Its IUPAC name is [2-[4-formyloxy-6-[4-[2-(3-hexylthiophen-2-yl)ethynyl]-1,3,5-triazin-2-yl]-2-pyridinyl]-4-pyridinyl] formate.
| Compound Name | [2-[4-formyloxy-6-[4-[2-(3-hexylthiophen-2-yl)ethynyl]-1,3,5-triazin-2-yl]-2-pyridinyl]-4-pyridinyl] formate |
|---|---|
| PubChem CID | 126726158 |
| Molecular Formula | C27H23N5O4S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | [2-[4-formyloxy-6-[4-[2-(3-hexylthiophen-2-yl)ethynyl]-1,3,5-triazin-2-yl]-2-pyridinyl]-4-pyridinyl] formate |
| SMILES | CCCCCCc1ccsc1C#Cc1ncnc(-c2cc(OC=O)cc(-c3cc(OC=O)ccn3)n2)n1 |
| InChI | InChI=1S/C27H23N5O4S/c1-2-3-4-5-6-19-10-12-37-25(19)7-8-26-29-16-30-27(32-26)24-15-21(36-18-34)14-23(31-24)22-13-20(35-17-33)9-11-28-22/h9-18H,2-6H2,1H3 |
| InChIKey | WYQAESTVGREFBQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 117.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|