C32H29N3O4S2 — CID 129061529
[2-[4-formyloxy-6-[4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-3-yl]-2-pyridinyl]-2-pyridinyl]-4-pyridinyl] formate (PubChem CID 129061529) has the molecular formula C32H29N3O4S2 and a molecular weight of 583.74 g/mol. Its IUPAC name is [2-[4-formyloxy-6-[4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-3-yl]-2-pyridinyl]-2-pyridinyl]-4-pyridinyl] formate.
| Compound Name | [2-[4-formyloxy-6-[4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-3-yl]-2-pyridinyl]-2-pyridinyl]-4-pyridinyl] formate |
|---|---|
| PubChem CID | 129061529 |
| Molecular Formula | C32H29N3O4S2 |
| Molecular Weight | 583.74 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | [2-[4-formyloxy-6-[4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-3-yl]-2-pyridinyl]-2-pyridinyl]-4-pyridinyl] formate |
| SMILES | CCCCCCc1cc(C)sc1-c1cc(-c2ccnc(-c3cc(OC=O)cc(-c4cc(OC=O)ccn4)n3)c2)cs1 |
| InChI | InChI=1S/C32H29N3O4S2/c1-3-4-5-6-7-23-12-21(2)41-32(23)31-14-24(18-40-31)22-8-10-33-27(13-22)29-16-26(39-20-37)17-30(35-29)28-15-25(38-19-36)9-11-34-28/h8-20H,3-7H2,1-2H3 |
| InChIKey | BTLMVVPMIZBQGJ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 91.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.74 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|