C24H21N3O — CID 126726519
2-[3-ethyl-2-[hydroxy(diphenyl)methyl]benzimidazol-5-yl]acetonitrile (PubChem CID 126726519) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[3-ethyl-2-[hydroxy(diphenyl)methyl]benzimidazol-5-yl]acetonitrile.
| Compound Name | 2-[3-ethyl-2-[hydroxy(diphenyl)methyl]benzimidazol-5-yl]acetonitrile |
|---|---|
| PubChem CID | 126726519 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[3-ethyl-2-[hydroxy(diphenyl)methyl]benzimidazol-5-yl]acetonitrile |
| SMILES | CCn1c(C(O)(c2ccccc2)c2ccccc2)nc2ccc(CC#N)cc21 |
| InChI | InChI=1S/C24H21N3O/c1-2-27-22-17-18(15-16-25)13-14-21(22)26-23(27)24(28,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-14,17,28H,2,15H2,1H3 |
| InChIKey | RNYIGRLYNCNHMX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |