C15H12N2O2S — CID 126728290
3-(methylamino)-4-[5-(2-methyl-4-pyridinyl)thiophen-2-yl]cyclobut-3-ene-1,2-dione (PubChem CID 126728290) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-(methylamino)-4-[5-(2-methyl-4-pyridinyl)thiophen-2-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(methylamino)-4-[5-(2-methyl-4-pyridinyl)thiophen-2-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 126728290 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-(methylamino)-4-[5-(2-methyl-4-pyridinyl)thiophen-2-yl]cyclobut-3-ene-1,2-dione |
| SMILES | CNc1c(-c2ccc(-c3ccnc(C)c3)s2)c(=O)c1=O |
| InChI | InChI=1S/C15H12N2O2S/c1-8-7-9(5-6-17-8)10-3-4-11(20-10)12-13(16-2)15(19)14(12)18/h3-7,16H,1-2H3 |
| InChIKey | QJNYXZOHCBNLNQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|