C10H6NO3- — CID 140692212
2-(2-methyl-4-pyridinyl)-3,4-dioxocyclobuten-1-olate (PubChem CID 140692212) has the molecular formula C10H6NO3- and a molecular weight of 188.16 g/mol. Its IUPAC name is 2-(2-methyl-4-pyridinyl)-3,4-dioxocyclobuten-1-olate.
| Compound Name | 2-(2-methyl-4-pyridinyl)-3,4-dioxocyclobuten-1-olate |
|---|---|
| PubChem CID | 140692212 |
| Molecular Formula | C10H6NO3- |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 2-(2-methyl-4-pyridinyl)-3,4-dioxocyclobuten-1-olate |
| SMILES | Cc1cc(-c2c([O-])c(=O)c2=O)ccn1 |
| InChI | InChI=1S/C10H7NO3/c1-5-4-6(2-3-11-5)7-8(12)10(14)9(7)13/h2-4,12H,1H3/p-1 |
| InChIKey | KUNOBQCJIDXQFE-UHFFFAOYSA-M |
| XLogP | -0.27 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|