C12H10N5PS — CID 126729495
[6-(1-methylbenzimidazol-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]phosphane (PubChem CID 126729495) has the molecular formula C12H10N5PS and a molecular weight of 287.29 g/mol. Its IUPAC name is [6-(1-methylbenzimidazol-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]phosphane.
| Compound Name | [6-(1-methylbenzimidazol-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]phosphane |
|---|---|
| PubChem CID | 126729495 |
| Molecular Formula | C12H10N5PS |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | [6-(1-methylbenzimidazol-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]phosphane |
| SMILES | Cn1c(-c2cn3nc(P)sc3n2)nc2ccccc21 |
| InChI | InChI=1S/C12H10N5PS/c1-16-9-5-3-2-4-7(9)13-10(16)8-6-17-11(14-8)19-12(18)15-17/h2-6H,18H2,1H3 |
| InChIKey | CQYJSUKJHZJBOD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|