C11H10N4S — CID 16789350
4-(1-methylbenzimidazol-2-yl)-1,3-thiazol-2-amine (PubChem CID 16789350) has the molecular formula C11H10N4S and a molecular weight of 230.30 g/mol. Its IUPAC name is 4-(1-methylbenzimidazol-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(1-methylbenzimidazol-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 16789350 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-(1-methylbenzimidazol-2-yl)-1,3-thiazol-2-amine |
| SMILES | Cn1c(-c2csc(N)n2)nc2ccccc21 |
| InChI | InChI=1S/C11H10N4S/c1-15-9-5-3-2-4-7(9)13-10(15)8-6-16-11(12)14-8/h2-6H,1H3,(H2,12,14) |
| InChIKey | PLKVCPSRUFTFTL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |