About 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine
4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 139972742) has the molecular formula C18H13F3N4S
and a molecular weight of 374.39 g/mol. Its IUPAC name is 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| PubChem CID | 139972742 |
| Molecular Formula | C18H13F3N4S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | Cn1c(-c2csc(Nc3ccc(C(F)(F)F)cc3)n2)nc2ccccc21 |
| InChI | InChI=1S/C18H13F3N4S/c1-25-15-5-3-2-4-13(15)23-16(25)14-10-26-17(24-14)22-12-8-6-11(7-9-12)18(19,20)21/h2-10H,1H3,(H,22,24) |
| InChIKey | SYGFUPKIFNLVSF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The IUPAC name of 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (CID 139972742) is 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine is Cn1c(-c2csc(Nc3ccc(C(F)(F)F)cc3)n2)nc2ccccc21.
What is the InChIKey of 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
The InChIKey is SYGFUPKIFNLVSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N4S/c1-25-15-5-3-2-4-13(15)23-16(25)14-10-26-17(24-14)22-12-8-6-11(7-9-12)18(19,20)21/h2-10H,1H3,(H,22,24).
What are the key properties of 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine?
4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine has a molecular weight of 374.39 g/mol, XLogP of 5.46, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methylbenzimidazol-2-yl)-N-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 139972742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).