C35H22N4O4S — CID 126729571
2-(4-carboxy-2-pyridinyl)-6-[4-[2-[5-(N-phenylanilino)thiophen-2-yl]ethynyl]-2-pyridinyl]pyridine-4-carboxylic acid (PubChem CID 126729571) has the molecular formula C35H22N4O4S and a molecular weight of 594.65 g/mol. Its IUPAC name is 2-(4-carboxy-2-pyridinyl)-6-[4-[2-[5-(N-phenylanilino)thiophen-2-yl]ethynyl]-2-pyridinyl]pyridine-4-carboxylic acid.
| Compound Name | 2-(4-carboxy-2-pyridinyl)-6-[4-[2-[5-(N-phenylanilino)thiophen-2-yl]ethynyl]-2-pyridinyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 126729571 |
| Molecular Formula | C35H22N4O4S |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | 2-(4-carboxy-2-pyridinyl)-6-[4-[2-[5-(N-phenylanilino)thiophen-2-yl]ethynyl]-2-pyridinyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(-c2cc(C(=O)O)cc(-c3cc(C#Cc4ccc(N(c5ccccc5)c5ccccc5)s4)ccn3)n2)c1 |
| InChI | InChI=1S/C35H22N4O4S/c40-34(41)24-16-18-37-30(20-24)32-22-25(35(42)43)21-31(38-32)29-19-23(15-17-36-29)11-12-28-13-14-33(44-28)39(26-7-3-1-4-8-26)27-9-5-2-6-10-27/h1-10,13-22H,(H,40,41)(H,42,43) |
| InChIKey | NNKWVBDPGAYVIX-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|