C31H21N5O2S — CID 158356478
[2-[4-[5-(N-phenylanilino)thiophen-2-yl]-2-pyridinyl]-6-pyrimidin-2-yl-4-pyridinyl] formate (PubChem CID 158356478) has the molecular formula C31H21N5O2S and a molecular weight of 527.61 g/mol. Its IUPAC name is [2-[4-[5-(N-phenylanilino)thiophen-2-yl]-2-pyridinyl]-6-pyrimidin-2-yl-4-pyridinyl] formate.
| Compound Name | [2-[4-[5-(N-phenylanilino)thiophen-2-yl]-2-pyridinyl]-6-pyrimidin-2-yl-4-pyridinyl] formate |
|---|---|
| PubChem CID | 158356478 |
| Molecular Formula | C31H21N5O2S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | [2-[4-[5-(N-phenylanilino)thiophen-2-yl]-2-pyridinyl]-6-pyrimidin-2-yl-4-pyridinyl] formate |
| SMILES | O=COc1cc(-c2cc(-c3ccc(N(c4ccccc4)c4ccccc4)s3)ccn2)nc(-c2ncccn2)c1 |
| InChI | InChI=1S/C31H21N5O2S/c37-21-38-25-19-27(35-28(20-25)31-33-15-7-16-34-31)26-18-22(14-17-32-26)29-12-13-30(39-29)36(23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-21H |
| InChIKey | HPFHRBOHCHBXLE-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|