C68H49N5 — CID 126729988
9-[4-[4-[2,6-bis(3-methylphenyl)pyrimidin-4-yl]-2,6-dimethylphenyl]phenyl]-3,6-di(carbazol-9-yl)carbazole (PubChem CID 126729988) has the molecular formula C68H49N5 and a molecular weight of 936.17 g/mol. Its IUPAC name is 9-[4-[4-[2,6-bis(3-methylphenyl)pyrimidin-4-yl]-2,6-dimethylphenyl]phenyl]-3,6-di(carbazol-9-yl)carbazole.
| Compound Name | 9-[4-[4-[2,6-bis(3-methylphenyl)pyrimidin-4-yl]-2,6-dimethylphenyl]phenyl]-3,6-di(carbazol-9-yl)carbazole |
|---|---|
| PubChem CID | 126729988 |
| Molecular Formula | C68H49N5 |
| Molecular Weight | 936.17 g/mol |
| Exact Mass | 935.40 |
| IUPAC Name | 9-[4-[4-[2,6-bis(3-methylphenyl)pyrimidin-4-yl]-2,6-dimethylphenyl]phenyl]-3,6-di(carbazol-9-yl)carbazole |
| SMILES | Cc1cccc(-c2cc(-c3cc(C)c(-c4ccc(-n5c6ccc(-n7c8ccccc8c8ccccc87)cc6c6cc(-n7c8ccccc8c8ccccc87)ccc65)cc4)c(C)c3)nc(-c3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C68H49N5/c1-42-15-13-17-47(35-42)59-41-60(70-68(69-59)48-18-14-16-43(2)36-48)49-37-44(3)67(45(4)38-49)46-27-29-50(30-28-46)71-65-33-31-51(72-61-23-9-5-19-53(61)54-20-6-10-24-62(54)72)39-57(65)58-40-52(32-34-66(58)71)73-63-25-11-7-21-55(63)56-22-8-12-26-64(56)73/h5-41H,1-4H3 |
| InChIKey | DFMFCWNDDPHOPR-UHFFFAOYSA-N |
| XLogP | 17.67 |
| TPSA | 40.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.17 |
| LogP ≤ 5 | 17.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |