C74H53N5 — CID 126730037
9-[4-[4-[4-[2,6-bis(3-methylphenyl)pyrimidin-4-yl]phenyl]phenyl]-2,6-dimethylphenyl]-3,6-di(carbazol-9-yl)carbazole (PubChem CID 126730037) has the molecular formula C74H53N5 and a molecular weight of 1012.27 g/mol. Its IUPAC name is 9-[4-[4-[4-[2,6-bis(3-methylphenyl)pyrimidin-4-yl]phenyl]phenyl]-2,6-dimethylphenyl]-3,6-di(carbazol-9-yl)carbazole.
| Compound Name | 9-[4-[4-[4-[2,6-bis(3-methylphenyl)pyrimidin-4-yl]phenyl]phenyl]-2,6-dimethylphenyl]-3,6-di(carbazol-9-yl)carbazole |
|---|---|
| PubChem CID | 126730037 |
| Molecular Formula | C74H53N5 |
| Molecular Weight | 1012.27 g/mol |
| Exact Mass | 1011.43 |
| IUPAC Name | 9-[4-[4-[4-[2,6-bis(3-methylphenyl)pyrimidin-4-yl]phenyl]phenyl]-2,6-dimethylphenyl]-3,6-di(carbazol-9-yl)carbazole |
| SMILES | Cc1cccc(-c2cc(-c3ccc(-c4ccc(-c5cc(C)c(-n6c7ccc(-n8c9ccccc9c9ccccc98)cc7c7cc(-n8c9ccccc9c9ccccc98)ccc76)c(C)c5)cc4)cc3)nc(-c3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C74H53N5/c1-46-15-13-17-54(39-46)66-45-65(75-74(76-66)55-18-14-16-47(2)40-55)53-33-31-51(32-34-53)50-27-29-52(30-28-50)56-41-48(3)73(49(4)42-56)79-71-37-35-57(77-67-23-9-5-19-59(67)60-20-6-10-24-68(60)77)43-63(71)64-44-58(36-38-72(64)79)78-69-25-11-7-21-61(69)62-22-8-12-26-70(62)78/h5-45H,1-4H3 |
| InChIKey | KAQGKOAORLEJTC-UHFFFAOYSA-N |
| XLogP | 19.34 |
| TPSA | 40.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.27 |
| LogP ≤ 5 | 19.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |