C21H35N2O7P — CID 126730975
tert-butyl N-[6-[4-[ethoxy(methyl)phosphoryl]oxy-3-(hydroxymethyl)anilino]-6-oxohexyl]carbamate (PubChem CID 126730975) has the molecular formula C21H35N2O7P and a molecular weight of 458.49 g/mol. Its IUPAC name is tert-butyl N-[6-[4-[ethoxy(methyl)phosphoryl]oxy-3-(hydroxymethyl)anilino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-[4-[ethoxy(methyl)phosphoryl]oxy-3-(hydroxymethyl)anilino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 126730975 |
| Molecular Formula | C21H35N2O7P |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | tert-butyl N-[6-[4-[ethoxy(methyl)phosphoryl]oxy-3-(hydroxymethyl)anilino]-6-oxohexyl]carbamate |
| SMILES | CCOP(C)(=O)Oc1ccc(NC(=O)CCCCCNC(=O)OC(C)(C)C)cc1CO |
| InChI | InChI=1S/C21H35N2O7P/c1-6-28-31(5,27)30-18-12-11-17(14-16(18)15-24)23-19(25)10-8-7-9-13-22-20(26)29-21(2,3)4/h11-12,14,24H,6-10,13,15H2,1-5H3,(H,22,26)(H,23,25) |
| InChIKey | PIGRBCLYUWGVBF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|