C18H30NO7P — CID 118335151
tert-butyl N-[2-[4-diethoxyphosphoryloxy-3-(hydroxymethyl)phenyl]ethyl]carbamate (PubChem CID 118335151) has the molecular formula C18H30NO7P and a molecular weight of 403.41 g/mol. Its IUPAC name is tert-butyl N-[2-[4-diethoxyphosphoryloxy-3-(hydroxymethyl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-diethoxyphosphoryloxy-3-(hydroxymethyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 118335151 |
| Molecular Formula | C18H30NO7P |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | tert-butyl N-[2-[4-diethoxyphosphoryloxy-3-(hydroxymethyl)phenyl]ethyl]carbamate |
| SMILES | CCOP(=O)(OCC)Oc1ccc(CCNC(=O)OC(C)(C)C)cc1CO |
| InChI | InChI=1S/C18H30NO7P/c1-6-23-27(22,24-7-2)26-16-9-8-14(12-15(16)13-20)10-11-19-17(21)25-18(3,4)5/h8-9,12,20H,6-7,10-11,13H2,1-5H3,(H,19,21) |
| InChIKey | QKQUVOIGRZPCBA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|