C18H30NO6P — CID 86752191
tert-butyl N-[2-[4-(diethoxyphosphorylmethoxy)phenyl]ethyl]carbamate (PubChem CID 86752191) has the molecular formula C18H30NO6P and a molecular weight of 387.41 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(diethoxyphosphorylmethoxy)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(diethoxyphosphorylmethoxy)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 86752191 |
| Molecular Formula | C18H30NO6P |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | tert-butyl N-[2-[4-(diethoxyphosphorylmethoxy)phenyl]ethyl]carbamate |
| SMILES | CCOP(=O)(COc1ccc(CCNC(=O)OC(C)(C)C)cc1)OCC |
| InChI | InChI=1S/C18H30NO6P/c1-6-23-26(21,24-7-2)14-22-16-10-8-15(9-11-16)12-13-19-17(20)25-18(3,4)5/h8-11H,6-7,12-14H2,1-5H3,(H,19,20) |
| InChIKey | UACIQQYRVGEUQK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|