C20H34N2O4 — CID 166114646
tert-butyl N-[2-[3-(diethylaminomethyl)-4-(methoxymethoxy)phenyl]ethyl]carbamate (PubChem CID 166114646) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(diethylaminomethyl)-4-(methoxymethoxy)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(diethylaminomethyl)-4-(methoxymethoxy)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 166114646 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | tert-butyl N-[2-[3-(diethylaminomethyl)-4-(methoxymethoxy)phenyl]ethyl]carbamate |
| SMILES | CCN(CC)Cc1cc(CCNC(=O)OC(C)(C)C)ccc1OCOC |
| InChI | InChI=1S/C20H34N2O4/c1-7-22(8-2)14-17-13-16(9-10-18(17)25-15-24-6)11-12-21-19(23)26-20(3,4)5/h9-10,13H,7-8,11-12,14-15H2,1-6H3,(H,21,23) |
| InChIKey | HYYAHDRUUPXNBC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|