C27H49NO4Sn — CID 44518721
tert-butyl N-[2-[4-(methoxymethoxy)-3-tributylstannylphenyl]ethyl]carbamate (PubChem CID 44518721) has the molecular formula C27H49NO4Sn and a molecular weight of 570.40 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(methoxymethoxy)-3-tributylstannylphenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(methoxymethoxy)-3-tributylstannylphenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 44518721 |
| Molecular Formula | C27H49NO4Sn |
| Molecular Weight | 570.40 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | tert-butyl N-[2-[4-(methoxymethoxy)-3-tributylstannylphenyl]ethyl]carbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(CCNC(=O)OC(C)(C)C)ccc1OCOC |
| InChI | InChI=1S/C15H22NO4.3C4H9.Sn/c1-15(2,3)20-14(17)16-10-9-12-5-7-13(8-6-12)19-11-18-4;3*1-3-4-2;/h5-7H,9-11H2,1-4H3,(H,16,17);3*1,3-4H2,2H3; |
| InChIKey | HNVKXCOYLARBIG-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.40 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|